Products 2563886-34-8
CAS 2563886-34-8 is the registry number for Tert-butyl (3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)carbamate, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Tert-butyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]carbamate (CAS 2563886-34-8) is a chemical compound with the molecular formula C15H24BNO4S and a molecular weight of 325.2 g/mol. IUPAC name: tert-butyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]carbamate. InChIKey: LAZMCWZZKMODOA-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO4S |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | tert-butyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]carbamate |
| InChIKey | LAZMCWZZKMODOA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)