CAS 256472-68-1 is the registry number for (S)-1-(2,3-Dihydrobenzofuran-4-yl)ethane-1,2-diol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(2,3-dihydro-1-benzofuran-4-yl)ethane-1,2-diol (CAS 256472-68-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: (1S)-1-(2,3-dihydro-1-benzofuran-4-yl)ethane-1,2-diol. InChIKey: GISHMZNHTLGCGK-SECBINFHSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (1S)-1-(2,3-dihydro-1-benzofuran-4-yl)ethane-1,2-diol |
| InChIKey | GISHMZNHTLGCGK-SECBINFHSA-N |
| SMILES | C1COC2=CC=CC(=C21)[C@@H](CO)O |
Computed by PubChem (NCBI)