CAS 256477-09-5 appears in our catalog under these names: UK–371804, UK-371804/ 95.81% (existing batch purity), UK-371804 98+%, N-[[1-[(Aminoiminomethyl)amino]-4-chloro-7-isoquinolinyl]sulfonyl]-2-methylalanine, 98+%, 98+%, UK-371804, 98.0%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid (CAS 256477-09-5) is a chemical compound with the molecular formula C14H16ClN5O4S and a molecular weight of 385.8 g/mol. IUPAC name: 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid. InChIKey: XSDAXWRCPTYNOD-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN5O4S |
|---|---|
| Molecular weight | 385.8 g/mol |
| IUPAC name | 2-[[4-chloro-1-(diaminomethylideneamino)isoquinolin-7-yl]sulfonylamino]-2-methylpropanoic acid |
| InChIKey | XSDAXWRCPTYNOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NS(=O)(=O)C1=CC2=C(C=C1)C(=CN=C2N=C(N)N)Cl |
Computed by PubChem (NCBI)