CAS 256523-74-7 is the registry number for Dimethyl 2-(3-fluoro-4-nitrophenyl)malonate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Dimethyl 2-(3-fluoro-4-nitrophenyl)propanedioate (CAS 256523-74-7) is a chemical compound with the molecular formula C11H10FNO6 and a molecular weight of 271.20 g/mol. IUPAC name: dimethyl 2-(3-fluoro-4-nitrophenyl)propanedioate. InChIKey: KRISPSKDENDBLQ-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO6 |
|---|---|
| Molecular weight | 271.20 g/mol |
| IUPAC name | dimethyl 2-(3-fluoro-4-nitrophenyl)propanedioate |
| InChIKey | KRISPSKDENDBLQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=C(C=C1)[N+](=O)[O-])F)C(=O)OC |
Computed by PubChem (NCBI)