CAS 211388-77-1 appears in our catalog under these names: (3-Fluoro-4-nitrophenyl)methylene diacetate, 95%, (3-Fluoro-4-nitrophenyl)methylene diacetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[acetyloxy-(3-fluoro-4-nitrophenyl)methyl] acetate (CAS 211388-77-1) is a chemical compound with the molecular formula C11H10FNO6 and a molecular weight of 271.20 g/mol. IUPAC name: [acetyloxy-(3-fluoro-4-nitrophenyl)methyl] acetate. InChIKey: AMXYFBGXACJEOW-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO6 |
|---|---|
| Molecular weight | 271.20 g/mol |
| IUPAC name | [acetyloxy-(3-fluoro-4-nitrophenyl)methyl] acetate |
| InChIKey | AMXYFBGXACJEOW-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC(=C(C=C1)[N+](=O)[O-])F)OC(=O)C |
Computed by PubChem (NCBI)