CAS 2565832-35-9 is the registry number for N'-(1-(3-Bromo-4-fluorophenyl)ethylidene)-4-methylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 100g, 1g, 5g.
N-[(Z)-1-(3-bromo-4-fluorophenyl)ethylideneamino]-4-methylbenzenesulfonamide (CAS 2565832-35-9) is a chemical compound with the molecular formula C15H14BrFN2O2S and a molecular weight of 385.3 g/mol. IUPAC name: N-[(Z)-1-(3-bromo-4-fluorophenyl)ethylideneamino]-4-methylbenzenesulfonamide. InChIKey: PCTFZFDSUYNMSE-WQRHYEAKSA-N.
| Molecular formula | C15H14BrFN2O2S |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | N-[(Z)-1-(3-bromo-4-fluorophenyl)ethylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | PCTFZFDSUYNMSE-WQRHYEAKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C(/C)\C2=CC(=C(C=C2)F)Br |
Computed by PubChem (NCBI)