CAS 2566-20-3 appears in our catalog under these names: Z-Gly-gly-gly-oh, 95%, Z–Gly–Gly–Gly–OH, Cbz-Gly-Gly-Gly-OH 97%, 3,6,9-Trioxo-1-phenyl-2-oxa-4,7,10-triazadodecan-12-oic acid, 98%, 98%, Cbz-Gly-Gly-Gly-OH, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100mg, 250mg, 100g.
2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetic acid (CAS 2566-20-3) is a chemical compound with the molecular formula C14H17N3O6 and a molecular weight of 323.30 g/mol. IUPAC name: 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetic acid. InChIKey: KPAYASDFVKQWMA-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O6 |
|---|---|
| Molecular weight | 323.30 g/mol |
| IUPAC name | 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetic acid |
| InChIKey | KPAYASDFVKQWMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC(=O)NCC(=O)NCC(=O)O |
Computed by PubChem (NCBI)