Products 2566497-96-7
CAS 2566497-96-7 is the registry number for Antitumor agent-68. Offered by: MedChemExpress. Available pack sizes: Get quote.
1H-indol-5-yl 3-phenylprop-2-ynoate (CAS 2566497-96-7) is a chemical compound with the molecular formula C17H11NO2 and a molecular weight of 261.27 g/mol. IUPAC name: 1H-indol-5-yl 3-phenylprop-2-ynoate. InChIKey: VLGSRCGJYOURLG-UHFFFAOYSA-N.
| Molecular formula | C17H11NO2 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | 1H-indol-5-yl 3-phenylprop-2-ynoate |
| InChIKey | VLGSRCGJYOURLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC(=O)OC2=CC3=C(C=C2)NC=C3 |
Computed by PubChem (NCBI)