Products 2566522-50-5
CAS 2566522-50-5 is the registry number for Antifungal agent 25. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-chloro-1-benzothiophen-2-yl)-4-(4-fluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-5H-1,3-oxazole (CAS 2566522-50-5) is a chemical compound with the molecular formula C20H14ClFN4OS and a molecular weight of 412.9 g/mol. IUPAC name: 2-(6-chloro-1-benzothiophen-2-yl)-4-(4-fluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-5H-1,3-oxazole. InChIKey: KTOAMCQQWXLGKV-UHFFFAOYSA-N.
| Molecular formula | C20H14ClFN4OS |
|---|---|
| Molecular weight | 412.9 g/mol |
| IUPAC name | 2-(6-chloro-1-benzothiophen-2-yl)-4-(4-fluorophenyl)-4-(1,2,4-triazol-1-ylmethyl)-5H-1,3-oxazole |
| InChIKey | KTOAMCQQWXLGKV-UHFFFAOYSA-N |
| SMILES | C1C(N=C(O1)C2=CC3=C(S2)C=C(C=C3)Cl)(CN4C=NC=N4)C5=CC=C(C=C5)F |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 25