Products 2566522-60-7
CAS 2566522-60-7 is the registry number for Antifungal agent 24. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-fluorophenyl)-2-[4-(2-fluorophenyl)phenyl]-4-(1,2,4-triazol-1-ylmethyl)-5H-1,3-oxazole (CAS 2566522-60-7) is a chemical compound with the molecular formula C24H18F2N4O and a molecular weight of 416.4 g/mol. IUPAC name: 4-(4-fluorophenyl)-2-[4-(2-fluorophenyl)phenyl]-4-(1,2,4-triazol-1-ylmethyl)-5H-1,3-oxazole. InChIKey: WTXFRMCKLJLVDP-UHFFFAOYSA-N.
| Molecular formula | C24H18F2N4O |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-2-[4-(2-fluorophenyl)phenyl]-4-(1,2,4-triazol-1-ylmethyl)-5H-1,3-oxazole |
| InChIKey | WTXFRMCKLJLVDP-UHFFFAOYSA-N |
| SMILES | C1C(N=C(O1)C2=CC=C(C=C2)C3=CC=CC=C3F)(CN4C=NC=N4)C5=CC=C(C=C5)F |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 24, orb1687879