CAS 256656-73-2 appears in our catalog under these names: 2–(4–Boronobenzamido)acetic acid, 2-(4-Boronobenzamido)acetic acid, 95%, 95%, 2-([4-(Dihydroxyboranyl)phenyl]formamido)acetic acid, 95%, N-(4-BORONOBENZOYL)GLYCINE, 95%. Offered by: GLPBio, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 25mg, 250mg, 1g, 5g.
2-[(4-boronobenzoyl)amino]acetic acid (CAS 256656-73-2) is a chemical compound with the molecular formula C9H10BNO5 and a molecular weight of 222.99 g/mol. IUPAC name: 2-[(4-boronobenzoyl)amino]acetic acid. InChIKey: SUAHEMDODCRDRG-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO5 |
|---|---|
| Molecular weight | 222.99 g/mol |
| IUPAC name | 2-[(4-boronobenzoyl)amino]acetic acid |
| InChIKey | SUAHEMDODCRDRG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCC(=O)O)(O)O |
Computed by PubChem (NCBI)