CAS 2567559-38-8 is the registry number for 2,5-Diisopropyl-4-methylthiophen-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-2,5-di(propan-2-yl)thiophen-3-amine (CAS 2567559-38-8) is a chemical compound with the molecular formula C11H19NS and a molecular weight of 197.34 g/mol. IUPAC name: 4-methyl-2,5-di(propan-2-yl)thiophen-3-amine. InChIKey: NOJHKTMLEIPIDP-UHFFFAOYSA-N.
| Molecular formula | C11H19NS |
|---|---|
| Molecular weight | 197.34 g/mol |
| IUPAC name | 4-methyl-2,5-di(propan-2-yl)thiophen-3-amine |
| InChIKey | NOJHKTMLEIPIDP-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1N)C(C)C)C(C)C |
Computed by PubChem (NCBI)