CAS 25676-73-7 is the registry number for 1,3,5-tribromo-2,4-dimethoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,3,5-tribromo-2,4-dimethoxybenzene (CAS 25676-73-7) is a chemical compound with the molecular formula C8H7Br3O2 and a molecular weight of 374.85 g/mol. IUPAC name: 1,3,5-tribromo-2,4-dimethoxybenzene. InChIKey: AZFRKBCSVYYWDW-UHFFFAOYSA-N.
| Molecular formula | C8H7Br3O2 |
|---|---|
| Molecular weight | 374.85 g/mol |
| IUPAC name | 1,3,5-tribromo-2,4-dimethoxybenzene |
| InChIKey | AZFRKBCSVYYWDW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1Br)Br)OC)Br |
Computed by PubChem (NCBI)