CAS 2567881-43-8 is the registry number for 2,4-Diphenyl-6-[4-(10-phenyl-9-anthracenyl)phenyl]-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-diphenyl-6-[4-(10-phenylanthracen-9-yl)phenyl]-1,3,5-triazine (CAS 2567881-43-8) is a chemical compound with the molecular formula C41H27N3 and a molecular weight of 561.7 g/mol. IUPAC name: 2,4-diphenyl-6-[4-(10-phenylanthracen-9-yl)phenyl]-1,3,5-triazine. InChIKey: YBGWFFNAXIEYEK-UHFFFAOYSA-N.
| Molecular formula | C41H27N3 |
|---|---|
| Molecular weight | 561.7 g/mol |
| IUPAC name | 2,4-diphenyl-6-[4-(10-phenylanthracen-9-yl)phenyl]-1,3,5-triazine |
| InChIKey | YBGWFFNAXIEYEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC=C(C=C5)C6=NC(=NC(=N6)C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)