CAS 25679-39-4 appears in our catalog under these names: 3,5–Di–tert–butyl–4–hydroxybenzenesulfonic acid, 3,5-Di-tert-butyl-4-hydroxybenzenesulfonic acid, 95%, 3,5-Di-tert-butyl-4-hydroxybenzenesulfonic acid 95%, 3,5-Di-tert-butyl-4-hydroxybenzenesulfonic acid, 97%, 3,5-Di-tert-butyl-4-hydroxybenzenesulfonic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg.
3,5-ditert-butyl-4-hydroxybenzenesulfonic acid (CAS 25679-39-4) is a chemical compound with the molecular formula C14H22O4S and a molecular weight of 286.39 g/mol. IUPAC name: 3,5-ditert-butyl-4-hydroxybenzenesulfonic acid. InChIKey: KSIARAUEABNFDL-UHFFFAOYSA-N.
| Molecular formula | C14H22O4S |
|---|---|
| Molecular weight | 286.39 g/mol |
| IUPAC name | 3,5-ditert-butyl-4-hydroxybenzenesulfonic acid |
| InChIKey | KSIARAUEABNFDL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)S(=O)(=O)O |
Computed by PubChem (NCBI)