Products 2567957-94-0
CAS 2567957-94-0 is the registry number for N,N-Dimethylethanolamine-d10 (OH), 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
2-[bis(trideuteriomethyl)amino]-1,1,2,2-tetradeuterioethanol (CAS 2567957-94-0) is a chemical compound with the molecular formula C4H11NO and a molecular weight of 99.20 g/mol. IUPAC name: 2-[bis(trideuteriomethyl)amino]-1,1,2,2-tetradeuterioethanol. InChIKey: UEEJHVSXFDXPFK-MWUKXHIBSA-N.
| Molecular formula | C4H11NO |
|---|---|
| Molecular weight | 99.20 g/mol |
| IUPAC name | 2-[bis(trideuteriomethyl)amino]-1,1,2,2-tetradeuterioethanol |
| InChIKey | UEEJHVSXFDXPFK-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)