CAS 2568016-10-2 is the registry number for MAO-B-IN-42. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]phenol (CAS 2568016-10-2) is a chemical compound with the molecular formula C19H12FNO2 and a molecular weight of 305.3 g/mol. IUPAC name: 4-[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]phenol. InChIKey: POFSWVOMBQPVOZ-UHFFFAOYSA-N.
| Molecular formula | C19H12FNO2 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 4-[2-(3-fluorophenyl)-1,3-benzoxazol-6-yl]phenol |
| InChIKey | POFSWVOMBQPVOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC3=C(O2)C=C(C=C3)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)