Products 25683-10-7

CAS 25683-10-7 is the registry number for 6-Methyl-2-oxo-2h-pyran-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-methyl-6-oxopyran-3-carboxylic acid (CAS 25683-10-7) is a chemical compound with the molecular formula C7H6O4 and a molecular weight of 154.12 g/mol. IUPAC name: 2-methyl-6-oxopyran-3-carboxylic acid. InChIKey: SFORAEUKIGXMPR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6O4
Molecular weight154.12 g/mol
IUPAC name2-methyl-6-oxopyran-3-carboxylic acid
InChIKeySFORAEUKIGXMPR-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=O)O1)C(=O)O

Computed by PubChem (NCBI)