CAS 2568492-44-2 appears in our catalog under these names: 1–Arachidonoyl–d5–rac–glycerol, 1-Arachidonoyl-d5-rac-glycerol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 100μg, 5mg, 500μg.
(1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate (CAS 2568492-44-2) is a chemical compound with the molecular formula C23H38O4 and a molecular weight of 383.6 g/mol. IUPAC name: (1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate. InChIKey: DCPCOKIYJYGMDN-HIBOLZFCSA-N.
| Molecular formula | C23H38O4 |
|---|---|
| Molecular weight | 383.6 g/mol |
| IUPAC name | (1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) (5E,8E,11E,14E)-icosa-5,8,11,14-tetraenoate |
| InChIKey | DCPCOKIYJYGMDN-HIBOLZFCSA-N |
| SMILES | [2H]C([2H])(C([2H])(C([2H])([2H])OC(=O)CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCC)O)O |
Computed by PubChem (NCBI)