CAS 25693-94-1 appears in our catalog under these names: 4-Amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile, 95%, 4-Amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile (CAS 25693-94-1) is a chemical compound with the molecular formula C8H2F3N3 and a molecular weight of 197.12 g/mol. IUPAC name: 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile. InChIKey: DWSBLPOJFMENII-UHFFFAOYSA-N.
| Molecular formula | C8H2F3N3 |
|---|---|
| Molecular weight | 197.12 g/mol |
| IUPAC name | 4-amino-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| InChIKey | DWSBLPOJFMENII-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(C(=C(C(=C1F)N)F)F)C#N |
Computed by PubChem (NCBI)