CAS 256936-25-1 appears in our catalog under these names: 2-Methoxy-4-methoxycarbonylbenzoic Acid, 2-Methoxy-4-(methoxycarbonyl)benzoic acid, 2-Methoxy-4-(methoxycarbonyl)benzoic acid 98%, 1,4-Benzenedicarboxylic acid, 2-methoxy-, 4-methyl ester, 98%, 98%, 2-Methoxy-4-(methoxycarbonyl)benzoic acid, 98%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-methoxy-4-methoxycarbonylbenzoate (CAS 256936-25-1) is a chemical compound with the molecular formula C10H9O5- and a molecular weight of 209.17 g/mol. IUPAC name: 2-methoxy-4-methoxycarbonylbenzoate. InChIKey: KDMXUDOMAMCSBX-UHFFFAOYSA-M.
| Molecular formula | C10H9O5- |
|---|---|
| Molecular weight | 209.17 g/mol |
| IUPAC name | 2-methoxy-4-methoxycarbonylbenzoate |
| InChIKey | KDMXUDOMAMCSBX-UHFFFAOYSA-M |
| SMILES | COC1=C(C=CC(=C1)C(=O)OC)C(=O)[O-] |
Computed by PubChem (NCBI)