CAS 2570190-01-9 is the registry number for 4-[(4-bromobenzene)sulfinyl]piperidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(4-bromophenyl)sulfinylpiperidine;hydrochloride (CAS 2570190-01-9) is a chemical compound with the molecular formula C11H15BrClNOS and a molecular weight of 324.67 g/mol. IUPAC name: 4-(4-bromophenyl)sulfinylpiperidine;hydrochloride. InChIKey: BUAHXWDPYJDTRB-UHFFFAOYSA-N.
| Molecular formula | C11H15BrClNOS |
|---|---|
| Molecular weight | 324.67 g/mol |
| IUPAC name | 4-(4-bromophenyl)sulfinylpiperidine;hydrochloride |
| InChIKey | BUAHXWDPYJDTRB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1S(=O)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)