Products 2570190-11-1
CAS 2570190-11-1 is the registry number for {4-[4-(Carboxymethyl)-3-fluorophenyl]-2-fluorophenyl}acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[4-[4-(carboxymethyl)-3-fluorophenyl]-2-fluorophenyl]acetic acid (CAS 2570190-11-1) is a chemical compound with the molecular formula C16H12F2O4 and a molecular weight of 306.26 g/mol. IUPAC name: 2-[4-[4-(carboxymethyl)-3-fluorophenyl]-2-fluorophenyl]acetic acid. InChIKey: HXVREMPRQWTJFI-UHFFFAOYSA-N.
| Molecular formula | C16H12F2O4 |
|---|---|
| Molecular weight | 306.26 g/mol |
| IUPAC name | 2-[4-[4-(carboxymethyl)-3-fluorophenyl]-2-fluorophenyl]acetic acid |
| InChIKey | HXVREMPRQWTJFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)CC(=O)O)F)F)CC(=O)O |
Computed by PubChem (NCBI)