CAS 2570190-16-6 is the registry number for 2-[2-(benzyloxy)ethoxy]-1,4-dibromobenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,4-dibromo-2-(2-phenylmethoxyethoxy)benzene (CAS 2570190-16-6) is a chemical compound with the molecular formula C15H14Br2O2 and a molecular weight of 386.08 g/mol. IUPAC name: 1,4-dibromo-2-(2-phenylmethoxyethoxy)benzene. InChIKey: VXVVTKFPLJWTJN-UHFFFAOYSA-N.
| Molecular formula | C15H14Br2O2 |
|---|---|
| Molecular weight | 386.08 g/mol |
| IUPAC name | 1,4-dibromo-2-(2-phenylmethoxyethoxy)benzene |
| InChIKey | VXVVTKFPLJWTJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOC2=C(C=CC(=C2)Br)Br |
Computed by PubChem (NCBI)