CAS 2570190-22-4 appears in our catalog under these names: 5-bromo-3-(dimethoxymethyl)-2-fluoropyridine, 98%, 5-Bromo-3-(dimethoxymethyl)-2-fluoropyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
5-bromo-3-(dimethoxymethyl)-2-fluoropyridine (CAS 2570190-22-4) is a chemical compound with the molecular formula C8H9BrFNO2 and a molecular weight of 250.06 g/mol. IUPAC name: 5-bromo-3-(dimethoxymethyl)-2-fluoropyridine. InChIKey: XSNNAHCZHJNTON-UHFFFAOYSA-N.
| Molecular formula | C8H9BrFNO2 |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | 5-bromo-3-(dimethoxymethyl)-2-fluoropyridine |
| InChIKey | XSNNAHCZHJNTON-UHFFFAOYSA-N |
| SMILES | COC(C1=C(N=CC(=C1)Br)F)OC |
Computed by PubChem (NCBI)