Products 2570386-36-4

CAS 2570386-36-4 is the registry number for MEK4 inhibitor-1, 98.89%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg, 100 mg, 50 mg.

Structural formula: {0} (CAS {1})

4-(6-fluoro-1H-indazol-3-yl)benzenesulfonamide (CAS 2570386-36-4) is a chemical compound with the molecular formula C13H10FN3O2S and a molecular weight of 291.30 g/mol. IUPAC name: 4-(6-fluoro-1H-indazol-3-yl)benzenesulfonamide. InChIKey: PKPLGKVAJMCSQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10FN3O2S
Molecular weight291.30 g/mol
IUPAC name4-(6-fluoro-1H-indazol-3-yl)benzenesulfonamide
InChIKeyPKPLGKVAJMCSQQ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NNC3=C2C=CC(=C3)F)S(=O)(=O)N

Computed by PubChem (NCBI)

Synonyms: orb1690760