Products 25707-30-6
CAS 25707-30-6 is the registry number for Cryptosporiopsin. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (1R,5R)-3,5-dichloro-1-hydroxy-4-oxo-2-[(E)-prop-1-enyl]cyclopent-2-ene-1-carboxylate (CAS 25707-30-6) is a chemical compound with the molecular formula C10H10Cl2O4 and a molecular weight of 265.09 g/mol. IUPAC name: methyl (1R,5R)-3,5-dichloro-1-hydroxy-4-oxo-2-[(E)-prop-1-enyl]cyclopent-2-ene-1-carboxylate. InChIKey: VFXXEEUGYINLKM-PVXSWLFQSA-N.
| Molecular formula | C10H10Cl2O4 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | methyl (1R,5R)-3,5-dichloro-1-hydroxy-4-oxo-2-[(E)-prop-1-enyl]cyclopent-2-ene-1-carboxylate |
| InChIKey | VFXXEEUGYINLKM-PVXSWLFQSA-N |
| SMILES | C/C=C/C1=C(C(=O)[C@@H]([C@@]1(C(=O)OC)O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Cryptosporiopsin, CRYTOSPORIOPSIN