Products 2571068-74-9

CAS 2571068-74-9 is the registry number for YK-2168, 98.05%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 5 mg, 10 mg, 10mM/1mL.

Structural formula: {0} (CAS {1})

5-chloro-4-(1-methylpyrazol-4-yl)-2-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine (CAS 2571068-74-9) is a chemical compound with the molecular formula C16H18ClN5 and a molecular weight of 315.80 g/mol. IUPAC name: 5-chloro-4-(1-methylpyrazol-4-yl)-2-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine. InChIKey: HXJZLLNYPHBNSR-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18ClN5
Molecular weight315.80 g/mol
IUPAC name5-chloro-4-(1-methylpyrazol-4-yl)-2-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine
InChIKeyHXJZLLNYPHBNSR-UHFFFAOYSA-N
SMILESCN1C=C(C=N1)C2=C3C=C(NC3=NC=C2Cl)C4CCNCC4

Computed by PubChem (NCBI)

Synonyms: orb2664874