CAS 2571574-70-2 is the registry number for Se-NADA. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
(2R)-2-amino-3-[(4-nitro-2,1,3-benzoselenadiazol-7-yl)amino]propanoic acid;hydrochloride (CAS 2571574-70-2) is a chemical compound with the molecular formula C9H10ClN5O4Se and a molecular weight of 366.63 g/mol. IUPAC name: (2R)-2-amino-3-[(4-nitro-2,1,3-benzoselenadiazol-7-yl)amino]propanoic acid;hydrochloride. InChIKey: NGEWTJCJCRCRQS-PGMHMLKASA-N.
| Molecular formula | C9H10ClN5O4Se |
|---|---|
| Molecular weight | 366.63 g/mol |
| IUPAC name | (2R)-2-amino-3-[(4-nitro-2,1,3-benzoselenadiazol-7-yl)amino]propanoic acid;hydrochloride |
| InChIKey | NGEWTJCJCRCRQS-PGMHMLKASA-N |
| SMILES | C1=C(C2=N[Se]N=C2C(=C1)[N+](=O)[O-])NC[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)