CAS 25717-64-0 appears in our catalog under these names: 6-Amino-4,5-dichloro-2-methylpyridazin-3(2H)-one, 97%, 6-Amino-4,5-dichloro-2-methyl-2,3-dihydropyridazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g, 50mg.
6-amino-4,5-dichloro-2-methylpyridazin-3-one (CAS 25717-64-0) is a chemical compound with the molecular formula C5H5Cl2N3O and a molecular weight of 194.02 g/mol. IUPAC name: 6-amino-4,5-dichloro-2-methylpyridazin-3-one. InChIKey: GULOUPUQAFQFNK-UHFFFAOYSA-N.
| Molecular formula | C5H5Cl2N3O |
|---|---|
| Molecular weight | 194.02 g/mol |
| IUPAC name | 6-amino-4,5-dichloro-2-methylpyridazin-3-one |
| InChIKey | GULOUPUQAFQFNK-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(C(=N1)N)Cl)Cl |
Computed by PubChem (NCBI)