CAS 25725-11-5 is the registry number for tert-Butyl-d9 Alcohol, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g.
1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-ol (CAS 25725-11-5) is a chemical compound with the molecular formula C4H10O and a molecular weight of 83.18 g/mol. IUPAC name: 1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-ol. InChIKey: DKGAVHZHDRPRBM-GQALSZNTSA-N.
| Molecular formula | C4H10O |
|---|---|
| Molecular weight | 83.18 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-ol |
| InChIKey | DKGAVHZHDRPRBM-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)