Products 25725-11-5

CAS 25725-11-5 is the registry number for tert-Butyl-d9 Alcohol, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-ol (CAS 25725-11-5) is a chemical compound with the molecular formula C4H10O and a molecular weight of 83.18 g/mol. IUPAC name: 1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-ol. InChIKey: DKGAVHZHDRPRBM-GQALSZNTSA-N.

Identity
Molecular formulaC4H10O
Molecular weight83.18 g/mol
IUPAC name1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-ol
InChIKeyDKGAVHZHDRPRBM-GQALSZNTSA-N
SMILES[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O

Computed by PubChem (NCBI)