CAS 2573212-69-6 is the registry number for 2-Chloro-1-((1R,2R)-2-fluorocyclopropyl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone (CAS 2573212-69-6) is a chemical compound with the molecular formula C5H6ClFO and a molecular weight of 136.55 g/mol. IUPAC name: 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone. InChIKey: NMMRTNVBZMZWLU-IUYQGCFVSA-N.
| Molecular formula | C5H6ClFO |
|---|---|
| Molecular weight | 136.55 g/mol |
| IUPAC name | 2-chloro-1-[(1R,2R)-2-fluorocyclopropyl]ethanone |
| InChIKey | NMMRTNVBZMZWLU-IUYQGCFVSA-N |
| SMILES | C1[C@@H]([C@@H]1F)C(=O)CCl |
Computed by PubChem (NCBI)