Products 2573214-08-9
CAS 2573214-08-9 is the registry number for 2-Bromo-1-(1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-(1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)ethanone (CAS 2573214-08-9) is a chemical compound with the molecular formula C10H15BrO2 and a molecular weight of 247.13 g/mol. IUPAC name: 2-bromo-1-(1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)ethanone. InChIKey: NFOLLKNAYVVIRS-UHFFFAOYSA-N.
| Molecular formula | C10H15BrO2 |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 2-bromo-1-(1,3,3-trimethyl-2-oxabicyclo[2.1.1]hexan-4-yl)ethanone |
| InChIKey | NFOLLKNAYVVIRS-UHFFFAOYSA-N |
| SMILES | CC1(C2(CC(C2)(O1)C)C(=O)CBr)C |
Computed by PubChem (NCBI)