CAS 25753-15-5 appears in our catalog under these names: 3-Trifluoromethylbenzoic anhydride, 97%, 3-Trifluoromethylbenzoic anhydride, 97% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
[3-(trifluoromethyl)benzoyl] 3-(trifluoromethyl)benzoate (CAS 25753-15-5) is a chemical compound with the molecular formula C16H8F6O3 and a molecular weight of 362.22 g/mol. IUPAC name: [3-(trifluoromethyl)benzoyl] 3-(trifluoromethyl)benzoate. InChIKey: BYLMYFXAIMTZIC-UHFFFAOYSA-N.
| Molecular formula | C16H8F6O3 |
|---|---|
| Molecular weight | 362.22 g/mol |
| IUPAC name | [3-(trifluoromethyl)benzoyl] 3-(trifluoromethyl)benzoate |
| InChIKey | BYLMYFXAIMTZIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)OC(=O)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)