CAS 25753-21-3 is the registry number for 2,4,6-Tris(trifluoromethyl)benzamide, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg.
2,4,6-tris(trifluoromethyl)benzamide (CAS 25753-21-3) is a chemical compound with the molecular formula C10H4F9NO and a molecular weight of 325.13 g/mol. IUPAC name: 2,4,6-tris(trifluoromethyl)benzamide. InChIKey: JULXQCOKFJQXHV-UHFFFAOYSA-N.
| Molecular formula | C10H4F9NO |
|---|---|
| Molecular weight | 325.13 g/mol |
| IUPAC name | 2,4,6-tris(trifluoromethyl)benzamide |
| InChIKey | JULXQCOKFJQXHV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)C(=O)N)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)