CAS 25759-97-1 appears in our catalog under these names: Diazepam Impurity 10, Diazepam Impurity 15, Diazepam Impurity 14. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-chloro-4-phenyl-3-pyridin-1-ium-1-yl-1H-quinolin-2-one chloride (CAS 25759-97-1) is a chemical compound with the molecular formula C20H14Cl2N2O and a molecular weight of 369.2 g/mol. IUPAC name: 6-chloro-4-phenyl-3-pyridin-1-ium-1-yl-1H-quinolin-2-one chloride. InChIKey: GSDCXTFHUFOTRA-UHFFFAOYSA-N.
| Molecular formula | C20H14Cl2N2O |
|---|---|
| Molecular weight | 369.2 g/mol |
| IUPAC name | 6-chloro-4-phenyl-3-pyridin-1-ium-1-yl-1H-quinolin-2-one chloride |
| InChIKey | GSDCXTFHUFOTRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC3=C2C=C(C=C3)Cl)[N+]4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)