Products 257603-40-0
CAS 257603-40-0 appears in our catalog under these names: J-104129 fumarate, J 104129 fumarate, J 104129 (fumarate). Offered by: TargetMol, Biosynth, MedChemExpress. Available pack sizes: 10mg, 50mg, 25mg, 100mg, 1 mg, 5 mg, 10 mg.
(E)-but-2-enedioic acid;(2R)-2-cyclopentyl-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-phenylacetamide (CAS 257603-40-0) is a chemical compound with the molecular formula C28H40N2O6 and a molecular weight of 500.6 g/mol. IUPAC name: (E)-but-2-enedioic acid;(2R)-2-cyclopentyl-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-phenylacetamide. InChIKey: HUCQUCITPHOUAC-DSSYAJFBSA-N.
| Molecular formula | C28H40N2O6 |
|---|---|
| Molecular weight | 500.6 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;(2R)-2-cyclopentyl-2-hydroxy-N-[1-(4-methylpent-3-enyl)piperidin-4-yl]-2-phenylacetamide |
| InChIKey | HUCQUCITPHOUAC-DSSYAJFBSA-N |
| SMILES | CC(=CCCN1CCC(CC1)NC(=O)[C@@](C2CCCC2)(C3=CC=CC=C3)O)C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)