CAS 257625-05-1 is the registry number for 2-(4-(Trifluoromethyl)phenyl)-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(trifluoromethyl)phenyl]-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 257625-05-1) is a chemical compound with the molecular formula C16H12F3NOS and a molecular weight of 323.3 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: CCDWRGBDYHWSBR-UHFFFAOYSA-N.
| Molecular formula | C16H12F3NOS |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | CCDWRGBDYHWSBR-UHFFFAOYSA-N |
| SMILES | C1C(SC2=CC=CC=C2NC1=O)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)