CAS 2576507-94-1 is the registry number for Fmoc-H2Gln(Trt)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxo-7-(tritylamino)heptanoic acid (CAS 2576507-94-1) is a chemical compound with the molecular formula C41H38N2O5 and a molecular weight of 638.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxo-7-(tritylamino)heptanoic acid. InChIKey: XMYVFWPNFRDSFC-QNGWXLTQSA-N.
| Molecular formula | C41H38N2O5 |
|---|---|
| Molecular weight | 638.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-7-oxo-7-(tritylamino)heptanoic acid |
| InChIKey | XMYVFWPNFRDSFC-QNGWXLTQSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CCCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)