CAS 2576690-78-1 appears in our catalog under these names: HSD 17B Inhibitor 1, HSD17B13–IN–9, HSD17B13-IN-9, 99.92%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 25 mg, 10 mg, 5 mg.
N-(3,6-dimethyl-9H-thioxanthen-9-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide (CAS 2576690-78-1) is a chemical compound with the molecular formula C22H17F3N2O2S and a molecular weight of 430.4 g/mol. IUPAC name: N-(3,6-dimethyl-9H-thioxanthen-9-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide. InChIKey: OKFSUZNKRZBHKX-UHFFFAOYSA-N.
| Molecular formula | C22H17F3N2O2S |
|---|---|
| Molecular weight | 430.4 g/mol |
| IUPAC name | N-(3,6-dimethyl-9H-thioxanthen-9-yl)-2-oxo-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| InChIKey | OKFSUZNKRZBHKX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(C3=C(S2)C=C(C=C3)C)NC(=O)C4=CC=C(NC4=O)C(F)(F)F |
Computed by PubChem (NCBI)