Products 2577287-83-1
CAS 2577287-83-1 is the registry number for 7-Bromo-6-methoxypyrido[3,2-d]pyrimidine-2,4(1H,3H)-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-6-methoxy-1H-pyrido[3,2-d]pyrimidine-2,4-dione (CAS 2577287-83-1) is a chemical compound with the molecular formula C8H6BrN3O3 and a molecular weight of 272.06 g/mol. IUPAC name: 7-bromo-6-methoxy-1H-pyrido[3,2-d]pyrimidine-2,4-dione. InChIKey: NDJQRMCCKSSAIQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O3 |
|---|---|
| Molecular weight | 272.06 g/mol |
| IUPAC name | 7-bromo-6-methoxy-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| InChIKey | NDJQRMCCKSSAIQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=N1)C(=O)NC(=O)N2)Br |
Computed by PubChem (NCBI)