CAS 257877-44-4 appears in our catalog under these names: Buspirone EP Impurity N, Buspirone Impurity 14(Buspirone EP Impurity N), 8,8'-(1,4-Butanediyl)bis-8-azaspiro(4.5)decane-7,9-dione, >95% (GC), 8,8'-(Butane-1,4-diyl)bis(8-azaspiro(4.5)decane-7,9-dione), 8,8′-(1,4-Butanediyl)bis[8-azaspiro[4.5]decane-7,9-dione], 95%+, 95%+. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg.
8-[4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione (CAS 257877-44-4) is a chemical compound with the molecular formula C22H32N2O4 and a molecular weight of 388.5 g/mol. IUPAC name: 8-[4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione. InChIKey: VBBOKKNQJOSKIX-UHFFFAOYSA-N.
| Molecular formula | C22H32N2O4 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | 8-[4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| InChIKey | VBBOKKNQJOSKIX-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC(=O)N(C(=O)C2)CCCCN3C(=O)CC4(CCCC4)CC3=O |
Computed by PubChem (NCBI)