CAS 257877-45-5 appears in our catalog under these names: Buspirone EP Impurity C, Buspirone Impurity 3(Buspirone EP Impurity C), 2,2'-(Butane-1,4-diylbis(piperazine-1,4-diyl))dipyrimidine, >95% (HPLC), 2,2'-(Butane-1,4-diylbis(piperazine-1,4-diyl))dipyrimidine, 1,4-Bis(4-(pyrimidin-2-yl)piperazin-1-yl)butane, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-[4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]piperazin-1-yl]pyrimidine (CAS 257877-45-5) is a chemical compound with the molecular formula C20H30N8 and a molecular weight of 382.5 g/mol. IUPAC name: 2-[4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]piperazin-1-yl]pyrimidine. InChIKey: JJVKBYFPRGPOFR-UHFFFAOYSA-N.
| Molecular formula | C20H30N8 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | 2-[4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]piperazin-1-yl]pyrimidine |
| InChIKey | JJVKBYFPRGPOFR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCCN2CCN(CC2)C3=NC=CC=N3)C4=NC=CC=N4 |
Computed by PubChem (NCBI)