Products 257892-34-5
CAS 257892-34-5 is the registry number for D-4418. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinoline-5-carboxamide (CAS 257892-34-5) is a chemical compound with the molecular formula C16H11Cl2N3O2 and a molecular weight of 348.2 g/mol. IUPAC name: N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinoline-5-carboxamide. InChIKey: FSDOTMQXIKBFKJ-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2N3O2 |
|---|---|
| Molecular weight | 348.2 g/mol |
| IUPAC name | N-(2,5-dichloro-3-pyridinyl)-8-methoxyquinoline-5-carboxamide |
| InChIKey | FSDOTMQXIKBFKJ-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)C(=O)NC3=C(N=CC(=C3)Cl)Cl)C=CC=N2 |
Computed by PubChem (NCBI)