Products 2579-67-1
CAS 2579-67-1 appears in our catalog under these names: Northebaine, 17-Northebaine, >95% (HPLC), 17-Northebaine. Offered by: GLPBio, TRC, Mikromol, Biosynth. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 0,05g, 0,1g.
(4R,7aR,12bS)-7,9-dimethoxy-1,2,3,4,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline (CAS 2579-67-1) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: (4R,7aR,12bS)-7,9-dimethoxy-1,2,3,4,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline. InChIKey: QKQQEIVDLRUZRP-UUWFMWQGSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | (4R,7aR,12bS)-7,9-dimethoxy-1,2,3,4,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
| InChIKey | QKQQEIVDLRUZRP-UUWFMWQGSA-N |
| SMILES | COC1=C2C3=C(C[C@@H]4C5=CC=C([C@@H]([C@@]53CCN4)O2)OC)C=C1 |
Computed by PubChem (NCBI)