CAS 25796-77-4 appears in our catalog under these names: 4H-Cyclopenta[2,1-b:3,4-b']dithiophen-4-one, 97%, 4H–Cyclopenta(1,2–b:5,4–b')dithiophen–4–one, 4H-Cyclopenta[1,2-b:5,4-b']dithiophen-4-one, >98.0%(GC), CPTD-O 98%, Cyclopenta[2,1-b:3,4-b']dithiophen-4-one 99%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 200mg, 100mg.
3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-one (CAS 25796-77-4) is a chemical compound with the molecular formula C9H4OS2 and a molecular weight of 192.3 g/mol. IUPAC name: 3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-one. InChIKey: HFIUHKXJUKKOIZ-UHFFFAOYSA-N.
| Molecular formula | C9H4OS2 |
|---|---|
| Molecular weight | 192.3 g/mol |
| IUPAC name | 3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-one |
| InChIKey | HFIUHKXJUKKOIZ-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=O)C3=C2SC=C3 |
Computed by PubChem (NCBI)