Products 2579696-45-8
CAS 2579696-45-8 is the registry number for Antimicrobial agent-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]phenyl]methanesulfonamide (CAS 2579696-45-8) is a chemical compound with the molecular formula C22H21N3O2S and a molecular weight of 391.5 g/mol. IUPAC name: N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]phenyl]methanesulfonamide. InChIKey: JPFSNUBRFGFBAR-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O2S |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | N-[3-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]phenyl]methanesulfonamide |
| InChIKey | JPFSNUBRFGFBAR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C3=CC=CC=C3N=C2C4=CC(=CC=C4)NS(=O)(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Antimicrobial agent-1, orb1688254