CAS 2580095-50-5 is the registry number for (3AS,7aS)-6,6-difluorooctahydro-3aH-isoindole-3a-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aS,7aS)-6,6-difluoro-2,3,4,5,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid (CAS 2580095-50-5) is a chemical compound with the molecular formula C9H13F2NO2 and a molecular weight of 205.20 g/mol. IUPAC name: (3aS,7aS)-6,6-difluoro-2,3,4,5,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid. InChIKey: JGEOPCXFCCHMOO-HTRCEHHLSA-N.
| Molecular formula | C9H13F2NO2 |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | (3aS,7aS)-6,6-difluoro-2,3,4,5,7,7a-hexahydro-1H-isoindole-3a-carboxylic acid |
| InChIKey | JGEOPCXFCCHMOO-HTRCEHHLSA-N |
| SMILES | C1CC(C[C@H]2[C@@]1(CNC2)C(=O)O)(F)F |
Computed by PubChem (NCBI)