CAS 2580098-90-2 is the registry number for ((1S,2S,5R)-3-Azabicyclo[3.1.0]hexan-2-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2S,5R)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine (CAS 2580098-90-2) is a chemical compound with the molecular formula C6H12N2 and a molecular weight of 112.17 g/mol. IUPAC name: [(1S,2S,5R)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine. InChIKey: TUIHCOLESXTWCL-HCWXCVPCSA-N.
| Molecular formula | C6H12N2 |
|---|---|
| Molecular weight | 112.17 g/mol |
| IUPAC name | [(1S,2S,5R)-3-azabicyclo[3.1.0]hexan-2-yl]methanamine |
| InChIKey | TUIHCOLESXTWCL-HCWXCVPCSA-N |
| SMILES | C1[C@@H]2[C@H]1[C@H](NC2)CN |
Computed by PubChem (NCBI)