CAS 2580145-51-1 is the registry number for Rel-sodium (1r,3r)-3-((tert-butoxycarbonyl)amino)cyclobutane-1-sulfinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-sulfinate (CAS 2580145-51-1) is a chemical compound with the molecular formula C9H16NNaO4S and a molecular weight of 257.28 g/mol. IUPAC name: sodium 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-sulfinate. InChIKey: UHGNFGCVKHATOT-UHFFFAOYSA-M.
| Molecular formula | C9H16NNaO4S |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | sodium 3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-sulfinate |
| InChIKey | UHGNFGCVKHATOT-UHFFFAOYSA-M |
| SMILES | CC(C)(C)OC(=O)NC1CC(C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)